EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:142657 - methyl pentadecanoate
| Formula | C16H32O2 |
| Net Charge | 0 |
| Average Mass | 256.430 |
| Monoisotopic Mass | 256.24023 |
| SMILES | CCCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C16H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18-2/h3-15H2,1-2H3 |
| InChIKey | XIUXKAZJZFLLDQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Capsicum frutescens (ncbitaxon:4073) | fruit (BTO:0000486) | PubMed (17562464) | Isolated from fruit extract. |
| Rhodococcus erythropolis (ncbitaxon:1833) | - | PubMed (15553786) | Strain: EK1 |
| Lonchocarpus montanus (IPNI:77099648-1) | root (BTO:0001188) | PubMed (17768528) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl pentadecanoate (CHEBI:142657) has functional parent pentadecanoic acid (CHEBI:42504) |
| methyl pentadecanoate (CHEBI:142657) has role bacterial metabolite (CHEBI:76969) |
| methyl pentadecanoate (CHEBI:142657) has role plant metabolite (CHEBI:76924) |
| methyl pentadecanoate (CHEBI:142657) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl pentadecanoate |
| Synonyms | Source |
|---|---|
| methyl n-pentadecanoate | ChemIDplus |
| pentadecanoic acid, methyl ester | ChemIDplus |
| n-pentadecanoic acid methyl ester | NIST Chemistry WebBook |
| pentadecanoic acid methyl ester | ChEBI |
| Citations |
|---|