EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O3 |
| Net Charge | 0 |
| Average Mass | 194.230 |
| Monoisotopic Mass | 194.09429 |
| SMILES | C/C=C(\C)c1cc(OC)c(C)c(=O)o1 |
| InChI | InChI=1S/C11H14O3/c1-5-7(2)9-6-10(13-4)8(3)11(12)14-9/h5-6H,1-4H3/b7-5+ |
| InChIKey | NRLCQITWKJENAT-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Magnaporthe oryzae (ncbitaxon:318829) | - | PubMed (30443971) | Obtained by overexpression of a polyketide synthase gene (NEC1) and an O-methyltransferase gene (NEC2). |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nectriapyrone (CHEBI:142639) has functional parent desmethylnectriapyrone (CHEBI:142640) |
| nectriapyrone (CHEBI:142639) has role fungal metabolite (CHEBI:76946) |
| nectriapyrone (CHEBI:142639) is a nectriapyrones (CHEBI:142638) |
| Incoming Relation(s) |
| nectriapyrone D (CHEBI:142799) has functional parent nectriapyrone (CHEBI:142639) |
| IUPAC Name |
|---|
| 6-[(2E)-but-2-en-2-yl]-4-methoxy-3-methyl-2H-pyran-2-one |
| UniProt Name | Source |
|---|---|
| nectriapyrone | UniProt |
| Citations |
|---|