EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | C[C@H](O)[C@H](O)/C=C/C=C/c1cccc(O)c1CO |
| InChI | InChI=1S/C14H18O4/c1-10(16)13(17)7-3-2-5-11-6-4-8-14(18)12(11)9-15/h2-8,10,13,15-18H,9H2,1H3/b5-2+,7-3+/t10-,13+/m0/s1 |
| InChIKey | FIAPAWSJVOXFNR-BZUCXLHXSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydropyriculariol (CHEBI:142637) has role fungal metabolite (CHEBI:76946) |
| dihydropyriculariol (CHEBI:142637) is a aromatic primary alcohol (CHEBI:33857) |
| dihydropyriculariol (CHEBI:142637) is a heptaketide (CHEBI:59872) |
| dihydropyriculariol (CHEBI:142637) is a homoallylic alcohol (CHEBI:134362) |
| dihydropyriculariol (CHEBI:142637) is a hydroxybenzyl alcohol (CHEBI:24679) |
| dihydropyriculariol (CHEBI:142637) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (2S,3R,4E,6E)-7-[3-hydroxy-2-(hydroxymethyl)phenyl]hepta-4,6-diene-2,3-diol |
| UniProt Name | Source |
|---|---|
| dihydropyriculariol | UniProt |
| Citations |
|---|