EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O4 |
| Net Charge | 0 |
| Average Mass | 248.278 |
| Monoisotopic Mass | 248.10486 |
| SMILES | [H]C(=O)c1c(O)cccc1/C=C/C=C/[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C14H16O4/c1-10(16)13(17)7-3-2-5-11-6-4-8-14(18)12(11)9-15/h2-10,13,16-18H,1H3/b5-2+,7-3+/t10-,13+/m0/s1 |
| InChIKey | UPAHLPUINKDRNK-BZUCXLHXSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyriculariol (CHEBI:142636) has role fungal metabolite (CHEBI:76946) |
| pyriculariol (CHEBI:142636) is a benzaldehydes (CHEBI:22698) |
| pyriculariol (CHEBI:142636) is a heptaketide (CHEBI:59872) |
| pyriculariol (CHEBI:142636) is a homoallylic alcohol (CHEBI:134362) |
| pyriculariol (CHEBI:142636) is a phenols (CHEBI:33853) |
| pyriculariol (CHEBI:142636) is a secondary allylic alcohol (CHEBI:134396) |
| pyriculariol (CHEBI:142636) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 2-[(1E,3E,5R,6S)-5,6-dihydroxyhepta-1,3-dien-1-yl]-6-hydroxybenzaldehyde |
| Synonyms | Source |
|---|---|
| (−)-pyriculariol | ChEBI |
| (−)-2-[(1E,3E,5R,6S)-5,6-dihydroxyhepta-1,3-dien-1-yl]-6-hydroxybenzaldehyde | ChEBI |
| UniProt Name | Source |
|---|---|
| pyriculariol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00023717 | KNApSAcK |
| Citations |
|---|