EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N5O3 |
| Net Charge | 0 |
| Average Mass | 183.127 |
| Monoisotopic Mass | 183.03924 |
| SMILES | NC1=NC2(NC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C5H5N5O3/c6-3-7-1(11)5(9-3)2(12)8-4(13)10-5/h(H3,6,7,9,11)(H2,8,10,12,13) |
| InChIKey | HJWQNCPSKFANJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiroiminodihydantoin (CHEBI:142623) has functional parent hydantoin (CHEBI:27612) |
| spiroiminodihydantoin (CHEBI:142623) has role mutagen (CHEBI:25435) |
| spiroiminodihydantoin (CHEBI:142623) is a azaspiro compound (CHEBI:35624) |
| IUPAC Name |
|---|
| 7-amino-1,3,6,8-tetraazaspiro[4.4]non-6-ene-2,4,9-trione |
| Citations |
|---|