EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O4 |
| Net Charge | -1 |
| Average Mass | 181.167 |
| Monoisotopic Mass | 181.05063 |
| SMILES | COc1cc(OC)cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C9H10O4/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3,(H,10,11)/p-1 |
| InChIKey | IWPZKOJSYQZABD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dimethoxybenzoate (CHEBI:142602) is a methoxybenzoate (CHEBI:25236) |
| 3,5-dimethoxybenzoate (CHEBI:142602) is conjugate base of 3,5-dimethoxybenzoic acid (CHEBI:142601) |
| Incoming Relation(s) |
| 3,5-dimethoxybenzoic acid (CHEBI:142601) is conjugate acid of 3,5-dimethoxybenzoate (CHEBI:142602) |
| IUPAC Name |
|---|
| 3,5-dimethoxybenzoate |