EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21O3 |
| Net Charge | -1 |
| Average Mass | 213.297 |
| Monoisotopic Mass | 213.14962 |
| SMILES | CCCCCCCCCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h2-10H2,1H3,(H,14,15)/p-1 |
| InChIKey | MIMUDKBBERJQHQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxododecanoate (CHEBI:142579) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 2-oxododecanoate (CHEBI:142579) is a medium-chain fatty acid anion (CHEBI:59558) |
| 2-oxododecanoate (CHEBI:142579) is a oxo fatty acid anion (CHEBI:59836) |
| 2-oxododecanoate (CHEBI:142579) is conjugate base of 2-oxododecanoic acid (CHEBI:142578) |
| 2-oxododecanoate (CHEBI:142579) is tautomer of 2-hydroxydodec-2-enoate (CHEBI:141781) |
| Incoming Relation(s) |
| 2-oxododecanoic acid (CHEBI:142578) is conjugate acid of 2-oxododecanoate (CHEBI:142579) |
| 2-hydroxydodec-2-enoate (CHEBI:141781) is tautomer of 2-oxododecanoate (CHEBI:142579) |
| IUPAC Name |
|---|
| 2-oxododecanoate |
| Synonyms | Source |
|---|---|
| 2-ketododecanoate | ChEBI |
| 2-oxolaurate | ChEBI |
| α-keto-dodecanoate | ChEBI |
| α-keto-laurate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-oxododecanoate | UniProt |