EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O3 |
| Net Charge | 0 |
| Average Mass | 214.305 |
| Monoisotopic Mass | 214.15689 |
| SMILES | CCCCCCCCCC=C(O)C(=O)O |
| InChI | InChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h10,13H,2-9H2,1H3,(H,14,15) |
| InChIKey | RPKAMUABMATLMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxydodec-2-enoic acid (CHEBI:142577) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxydodec-2-enoic acid (CHEBI:142577) is a enol (CHEBI:33823) |
| 2-hydroxydodec-2-enoic acid (CHEBI:142577) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| 2-hydroxydodec-2-enoic acid (CHEBI:142577) is a medium-chain fatty acid (CHEBI:59554) |
| 2-hydroxydodec-2-enoic acid (CHEBI:142577) is conjugate acid of 2-hydroxydodec-2-enoate (CHEBI:141781) |
| 2-hydroxydodec-2-enoic acid (CHEBI:142577) is tautomer of 2-oxododecanoic acid (CHEBI:142578) |
| Incoming Relation(s) |
| 2-hydroxydodec-2-enoate (CHEBI:141781) is conjugate base of 2-hydroxydodec-2-enoic acid (CHEBI:142577) |
| 2-oxododecanoic acid (CHEBI:142578) is tautomer of 2-hydroxydodec-2-enoic acid (CHEBI:142577) |
| Citations |
|---|