EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O4S |
| Net Charge | 0 |
| Average Mass | 348.424 |
| Monoisotopic Mass | 348.11438 |
| SMILES | [H][C@]1(NC(C)=O)CSC(=C2\C=CCCN2)/C=C(/C(=O)/C=C/C)OC1=O |
| InChI | InChI=1S/C17H20N2O4S/c1-3-6-14(21)15-9-16(12-7-4-5-8-18-12)24-10-13(17(22)23-15)19-11(2)20/h3-4,6-7,9,13,18H,5,8,10H2,1-2H3,(H,19,20)/b6-3+,15-9-,16-12+/t13-/m0/s1 |
| InChIKey | RHGMVWUZXGSXCT-IAGKGVPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces coelicolor (ncbitaxon:1902) | - | DOI (10.1039/c2sc20410j ) | Streptomyces coelicolor M145 after genetically engineered increase of the metabolic flux Strain: M145 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coelimycin P1 (CHEBI:142547) has parent hydride 1,5-oxathiocane (CHEBI:142569) |
| coelimycin P1 (CHEBI:142547) has role bacterial metabolite (CHEBI:76969) |
| coelimycin P1 (CHEBI:142547) is a acetamides (CHEBI:22160) |
| coelimycin P1 (CHEBI:142547) is a dihydropyridine (CHEBI:50075) |
| coelimycin P1 (CHEBI:142547) is a enamine (CHEBI:47989) |
| coelimycin P1 (CHEBI:142547) is a enone (CHEBI:51689) |
| coelimycin P1 (CHEBI:142547) is a lactone (CHEBI:25000) |
| coelimycin P1 (CHEBI:142547) is a organosulfur heterocyclic compound (CHEBI:38106) |
| IUPAC Name |
|---|
| N-[(3R,6E,7Z)-8-[(2E)-but-2-enoyl]-6-(5,6-dihydropyridin-2(1H)-ylidene)-2-oxo-3,4-dihydro-2H,6H-1,5-oxathiocin-3-yl]acetamide |
| Synonyms | Source |
|---|---|
| N-[(3R)-8-[(2E)-but-2-enoyl]-2-oxo-6-[(2E)-1,2,5,6-tetrahydropyridin-2-ylidene]-2,3,4,6-tetrahydro-1,5-oxathiocin-3-yl]acetamide | SUBMITTER |
| N-[(3R,6E,7Z)-8-[(E)-but-2-enoyl]-6-(2,3-dihydro-1H-pyridin-6-ylidene)-2-oxo-3,4-dihydro-1,5-oxathiocin-3-yl]acetamide | ChEBI |
| Citations |
|---|