EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O2 |
| Net Charge | 0 |
| Average Mass | 240.387 |
| Monoisotopic Mass | 240.20893 |
| SMILES | C[C@H]1CCC[C@@]2(C)CC[C@@H](C(C)(C)O)C[C@]12O |
| InChI | InChI=1S/C15H28O2/c1-11-6-5-8-14(4)9-7-12(13(2,3)16)10-15(11,14)17/h11-12,16-17H,5-10H2,1-4H3/t11-,12+,14-,15-/m0/s1 |
| InChIKey | DUMZYTYPNQNWMU-NEBZKDRISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cymbopogon distans (ncbitaxon:152208) | whole plant (BTO:0001461) | Article (Mathela, C.S., Melkani, A.B., Pant, A., Dev, V., Nelson, T.E., Hope, H. and Bottini, A.T. (1989) A eudesmanediol from Cymbopogon distans. Phytochemistry, 28(3), 936-938.) | Isolated from essential oil of plant. |
| Streptomyces anulatus (ncbitaxon:1892) | - | PubMed (29314238) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-epi-ent-eudesmane-5,11-diol (CHEBI:142536) has role bacterial metabolite (CHEBI:76969) |
| 7-epi-ent-eudesmane-5,11-diol (CHEBI:142536) has role plant metabolite (CHEBI:76924) |
| 7-epi-ent-eudesmane-5,11-diol (CHEBI:142536) is a carbobicyclic compound (CHEBI:36785) |
| 7-epi-ent-eudesmane-5,11-diol (CHEBI:142536) is a diol (CHEBI:23824) |
| 7-epi-ent-eudesmane-5,11-diol (CHEBI:142536) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| 7-epi-ent-eudesmane-5,11-diol (CHEBI:142536) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3R,4aS,5S,8aS)-3-(2-hydroxypropan-2-yl)-5,8a-dimethyloctahydronaphthalen-4a(2H)-ol |
| Synonyms | Source |
|---|---|
| (4β,5β,7β,10α)-5,11-eudesmanediol | ChEBI |
| eudesmane-2,11-diol | ChEBI |
| UniProt Name | Source |
|---|---|
| 7-epi-ent-eudesmane-5,11-diol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21651 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6966076 | Reaxys |
| Citations |
|---|