EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O5 |
| Net Charge | 0 |
| Average Mass | 366.413 |
| Monoisotopic Mass | 366.14672 |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(OC)cc4c(c3O2)C=CC(C)(C)O4)cc1 |
| InChI | InChI=1S/C22H22O5/c1-22(2)10-9-15-18(27-22)12-19(25-4)20-16(23)11-17(26-21(15)20)13-5-7-14(24-3)8-6-13/h5-10,12,17H,11H2,1-4H3/t17-/m0/s1 |
| InChIKey | BIVJHZMNOBBBLR-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycosmis citrifolia (ncbitaxon:650008) | leaf (BTO:0000713) | Article (Wu, T.S., Chang, F.C. and Wu, P.L. (1995) Flavonoids, amidosulfoxides and an alkaloid from the leaves of Glycosmis citrifolia. Phytochemistry, 39(6), 1453-1457.) | |
| Glycosmis pentaphylla (ncbitaxon:76967) | stem (BTO:0001300) | PubMed (22694263 ) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyflavanone A (CHEBI:142529) has role plant metabolite (CHEBI:76924) |
| glyflavanone A (CHEBI:142529) is a aromatic ether (CHEBI:35618) |
| glyflavanone A (CHEBI:142529) is a aromatic ketone (CHEBI:76224) |
| glyflavanone A (CHEBI:142529) is a extended flavonoid (CHEBI:71037) |
| glyflavanone A (CHEBI:142529) is a flavanones (CHEBI:28863) |
| glyflavanone A (CHEBI:142529) is a organic heterotricyclic compound (CHEBI:26979) |
| glyflavanone A (CHEBI:142529) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| (2S)-5-methoxy-2-(4-methoxyphenyl)-8,8-dimethyl-2,3-dihydro-4H,8H-pyrano[2,3-f]chromen-4-one |
| Synonym | Source |
|---|---|
| (2S)-5,4'-dimethoxy-6'',6''-dimethylpyrano[2'',3'':7,8]flavanone | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C00014232 | KNApSAcK |
| LMPK12140556 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:167568-52-7 | KNApSAcK |
| Citations |
|---|