EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15O3 |
| Net Charge | -1 |
| Average Mass | 207.249 |
| Monoisotopic Mass | 207.10267 |
| SMILES | CC/C=C\CC1C(=O)C=CC1CC(=O)[O-] |
| InChI | InChI=1S/C12H16O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,6-7,9-10H,2,5,8H2,1H3,(H,14,15)/p-1/b4-3- |
| InChIKey | KJWUKJXAYNQYSS-ARJAWSKDSA-M |
| Roles Classification |
|---|
| Biological Role: | jasmonates The jasmonates (JAs) are a group of plant hormones which help regulate plant growth and development. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-didehydrojasmonate (CHEBI:142502) is a jasmonic acid anion (CHEBI:136184) |
| UniProt Name | Source |
|---|---|
| a 4,5-didehydrojasmonate | UniProt |
| Citations |
|---|