EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46O4 |
| Net Charge | 0 |
| Average Mass | 386.617 |
| Monoisotopic Mass | 386.33961 |
| SMILES | CCCCCCCCCCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C23H46O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)27-21-22(25)20-24/h22,24-25H,2-21H2,1H3 |
| InChIKey | UMEKPPOFCOUEDT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ibervillea sonorae (ncbitaxon:354617) | root (BTO:0001188) | PubMed (17318782) | |
| Sida spinosa (ncbitaxon:108380) | aerial part (BTO:0001658) | PubMed (12648532) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-icosanoylglycerol (CHEBI:142495) has functional parent icosanoic acid (CHEBI:28822) |
| 1-icosanoylglycerol (CHEBI:142495) has role plant metabolite (CHEBI:76924) |
| 1-icosanoylglycerol (CHEBI:142495) is a 1-monoglyceride (CHEBI:35759) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl icosanoate |
| Synonyms | Source |
|---|---|
| 1-acylglycerol 20:0 | SUBMITTER |
| 1-arachidoylglycerol | SUBMITTER |
| 2,3-dihydroxypropyl eicosanoate | ChEBI |
| 3-eicosanoyloxy-propane-1,2-diol | ChEBI |
| 3-icosanoyloxy-propane-1,2-diol | ChEBI |
| eicosanoic acid 2,3-dihydroxypropyl ester | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-eicosanoylglycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1801550 | Reaxys |
| Citations |
|---|