EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15ClN2O |
| Net Charge | 0 |
| Average Mass | 262.740 |
| Monoisotopic Mass | 262.08729 |
| SMILES | NC(=O)[C@H]1CCCCc2c1nc1ccc(Cl)cc21 |
| InChI | InChI=1S/C14H15ClN2O/c15-8-5-6-12-11(7-8)9-3-1-2-4-10(14(16)18)13(9)17-12/h5-7,10,17H,1-4H2,(H2,16,18)/t10-/m0/s1 |
| InChIKey | ABIVOOWWGYJNLV-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CHIC-35 (CHEBI:142489) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| CHIC-35 (CHEBI:142489) is a aromatic compound (CHEBI:33655) |
| CHIC-35 (CHEBI:142489) is a organic heterotricyclic compound (CHEBI:26979) |
| CHIC-35 (CHEBI:142489) is a organochlorine compound (CHEBI:36683) |
| CHIC-35 (CHEBI:142489) is a primary carboxamide (CHEBI:140324) |
| IUPAC Name |
|---|
| (6S)-2-chloro-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-6-carboxamide |
| Synonyms | Source |
|---|---|
| Compound (S)-35 | SUBMITTER |
| SIRT1 Inhibitor IV, (S)-35 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10274604 | Reaxys |
| CAS:848193-72-6 | SUBMITTER |
| Citations |
|---|