EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | [H][C@]12C/C(C)=C/CC/C(C)=C/C[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h6-7,13-14H,3-5,8-9H2,1-2H3/b10-7+,11-6+/t13-,14+/m1/s1 |
| InChIKey | BBMLTTOFEBDQIR-IAJVGIPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula hupehensis (ncbitaxon:1805964) | - | PubMed (29086444) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-epi-inunolide (CHEBI:142470) has functional parent 8α-hydroxygermacra-1(10),4,11(13)-trien-12-oate (CHEBI:142490) |
| 8-epi-inunolide (CHEBI:142470) has role plant metabolite (CHEBI:76924) |
| 8-epi-inunolide (CHEBI:142470) is a germacranolide (CHEBI:73011) |
| IUPAC Name |
|---|
| (3aR,5E,9E,11aS)-6,10-dimethyl-3-methylene-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-2(3H)-one |
| UniProt Name | Source |
|---|---|
| 8-epi-inunolide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21663 | MetaCyc |
| Citations |
|---|