EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6Cl2 |
| Net Charge | 0 |
| Average Mass | 112.987 |
| Monoisotopic Mass | 111.98466 |
| SMILES | C[C@@H](Cl)CCl |
| InChI | InChI=1S/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3/t3-/m1/s1 |
| InChIKey | KNKRKFALVUDBJE-GSVOUGTGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-1,2-dichloropropane (CHEBI:142469) is a 1,2-dichloropropane (CHEBI:142468) |
| (R)-1,2-dichloropropane (CHEBI:142469) is enantiomer of (S)-1,2-dichloropropane (CHEBI:142471) |
| Incoming Relation(s) |
| rac-1,2-dichloropropane (CHEBI:82163) has part (R)-1,2-dichloropropane (CHEBI:142469) |
| (S)-1,2-dichloropropane (CHEBI:142471) is enantiomer of (R)-1,2-dichloropropane (CHEBI:142469) |
| IUPAC Name |
|---|
| (2R)-1,2-dichloropropane |
| Synonyms | Source |
|---|---|
| (2R)-dichloro-1,2 propane | ChEBI |
| (R)-1,2-DCP | ChEBI |
| (R)-propylene dichloride | ChEBI |
| (R)-α,β-dichloropropane | ChEBI |
| (R)-α,β-propylene dichloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1718882 | Reaxys |
| Citations |
|---|