EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | [H][C@@]12C/C(C)=C/CC/C(C)=C/C[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h6-7,13-14H,3-5,8-9H2,1-2H3/b10-7+,11-6+/t13-,14-/m1/s1 |
| InChIKey | BBMLTTOFEBDQIR-BQULMBIYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula racemosa (ncbitaxon:483693) | - | PubMed (17265245) | |
| Rudbeckia laciniata (ncbitaxon:52310) | - | PubMed (10945249) | |
| Stevia polyphylla (IPNI:251515-1) | aerial part (BTO:0001658) | Article (Zdero, C., Bohlmann, F., King, R.M. and Robinson, H. (1988) The first 12.8β-germacrolide and other constituents from bolivian Stevia species. Phytochemistry, 27(9), 2835-2842.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inunolide (CHEBI:142465) has functional parent 8β-hydroxygermacra-1(10),4,11(13)-trien-12-oate (CHEBI:142464) |
| inunolide (CHEBI:142465) has role plant metabolite (CHEBI:76924) |
| inunolide (CHEBI:142465) is a germacranolide (CHEBI:73011) |
| IUPAC Name |
|---|
| (3aR,5E,9E,11aR)-6,10-dimethyl-3-methylene-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-2(3H)-one |
| UniProt Name | Source |
|---|---|
| inunolide | UniProt |
| Citations |
|---|