EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17FN6 |
| Net Charge | 0 |
| Average Mass | 360.396 |
| Monoisotopic Mass | 360.14987 |
| SMILES | Nc1nc(-c2nn(Cc3ccccc3F)c3ncccc23)ncc1C1CC1 |
| InChI | InChI=1S/C20H17FN6/c21-16-6-2-1-4-13(16)11-27-20-14(5-3-9-23-20)17(26-27)19-24-10-15(12-7-8-12)18(22)25-19/h1-6,9-10,12H,7-8,11H2,(H2,22,24,25) |
| InChIKey | ATOAHNRJAXSBOR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAY 41-2272 (CHEBI:142435) has role antihypertensive agent (CHEBI:35674) |
| BAY 41-2272 (CHEBI:142435) has role platelet aggregation inhibitor (CHEBI:50427) |
| BAY 41-2272 (CHEBI:142435) has role soluble guanylate cyclase activator (CHEBI:76022) |
| BAY 41-2272 (CHEBI:142435) has role vasodilator agent (CHEBI:35620) |
| BAY 41-2272 (CHEBI:142435) is a aminopyrimidine (CHEBI:38338) |
| BAY 41-2272 (CHEBI:142435) is a cyclopropanes (CHEBI:51454) |
| BAY 41-2272 (CHEBI:142435) is a monofluorobenzenes (CHEBI:83575) |
| BAY 41-2272 (CHEBI:142435) is a pyrazolopyridine (CHEBI:46699) |
| IUPAC Name |
|---|
| 5-cyclopropyl-2-[1-(2-fluorobenzyl)-1H-pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| 5-cyclopropyl-2-(1-((2-fluorophenyl)methyl)-1H-pyrazolo(3,4-b)pyridin-3-yl)-4-pyrimidinamine | ChemIDplus |
| BAY 41-2272 | ChEBI |
| BAY-41-2272 | ChemIDplus |
| BAY-412272 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US6833364 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8867995 | Reaxys |
| CAS:256376-24-6 | ChemIDplus |
| Citations |
|---|