EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H39NO5 |
| Net Charge | 0 |
| Average Mass | 565.710 |
| Monoisotopic Mass | 565.28282 |
| SMILES | O=C(O)CCCCN(CCc1ccccc1OCc1ccc(CCc2ccccc2)cc1)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C36H39NO5/c38-35(39)12-6-7-24-37(26-30-19-21-33(22-20-30)36(40)41)25-23-32-10-4-5-11-34(32)42-27-31-17-15-29(16-18-31)14-13-28-8-2-1-3-9-28/h1-5,8-11,15-22H,6-7,12-14,23-27H2,(H,38,39)(H,40,41) |
| InChIKey | WPYWMXNXEZFMAK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinaciguat (CHEBI:142433) has role antihypertensive agent (CHEBI:35674) |
| cinaciguat (CHEBI:142433) has role soluble guanylate cyclase activator (CHEBI:76022) |
| cinaciguat (CHEBI:142433) has role vasodilator agent (CHEBI:35620) |
| cinaciguat (CHEBI:142433) is a aromatic ether (CHEBI:35618) |
| cinaciguat (CHEBI:142433) is a benzoic acids (CHEBI:22723) |
| cinaciguat (CHEBI:142433) is a dicarboxylic acid (CHEBI:35692) |
| cinaciguat (CHEBI:142433) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-({(4-carboxybutyl)[2-(2-{[4-(2-phenylethyl)benzyl]oxy}phenyl)ethyl]amino}methyl)benzoic acid |
| INNs | Source |
|---|---|
| cinaciguat | WHO MedNet |
| cinaciguat | WHO MedNet |
| cinaciguat | WHO MedNet |
| cinaciguatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 58-2667 | ChemIDplus |
| BAY582667 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Cinaciguat | Wikipedia |
| D07577 | KEGG DRUG |
| US2012010292 | Patent |
| Z90 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9676935 | Reaxys |
| CAS:329773-35-5 | ChemIDplus |
| CAS:329773-35-5 | KEGG DRUG |
| Citations |
|---|