EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16F2N8O2 |
| Net Charge | 0 |
| Average Mass | 426.387 |
| Monoisotopic Mass | 426.13643 |
| SMILES | COC(=O)Nc1c(N)nc(-c2nn(Cc3ccccc3F)c3ncc(F)cc23)nc1N |
| InChI | InChI=1S/C19H16F2N8O2/c1-31-19(30)25-14-15(22)26-17(27-16(14)23)13-11-6-10(20)7-24-18(11)29(28-13)8-9-4-2-3-5-12(9)21/h2-7H,8H2,1H3,(H,25,30)(H4,22,23,26,27) |
| InChIKey | QZFHIXARHDBPBY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vericiguat (CHEBI:142432) has role antihypertensive agent (CHEBI:35674) |
| vericiguat (CHEBI:142432) has role cardiovascular drug (CHEBI:35554) |
| vericiguat (CHEBI:142432) has role soluble guanylate cyclase activator (CHEBI:76022) |
| vericiguat (CHEBI:142432) has role vasodilator agent (CHEBI:35620) |
| vericiguat (CHEBI:142432) is a aminopyrimidine (CHEBI:38338) |
| vericiguat (CHEBI:142432) is a carbamate ester (CHEBI:23003) |
| vericiguat (CHEBI:142432) is a organofluorine compound (CHEBI:37143) |
| vericiguat (CHEBI:142432) is a pyrazolopyridine (CHEBI:46699) |
| IUPAC Name |
|---|
| methyl {4,6-diamino-2-[5-fluoro-1-(2-fluorobenzyl)-1H-pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-5-yl}carbamate |
| INNs | Source |
|---|---|
| vericiguat | WHO MedNet |
| vericiguat | WHO MedNet |
| vériciguat | WHO MedNet |
| vericiguatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 1021189 | ChEMBL |
| BAY-1021189 | ChemIDplus |
| BAY1021189 | ChemIDplus |
| methyl N-[4,6-diamino-2-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-5-yl]carbamate | ChEBI |
| MK-1242 | ChEBI |
| Brand Name | Source |
|---|---|
| Verquvo | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D11051 | KEGG DRUG |
| US2012022084 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22098890 | Reaxys |
| CAS:1350653-20-1 | ChemIDplus |
| Citations |
|---|