EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16F2N8O2 |
| Net Charge | 0 |
| Average Mass | 426.387 |
| Monoisotopic Mass | 426.13643 |
| SMILES | COC(=O)Nc1c(N)nc(-c2nn(Cc3ccccc3F)c3ncc(F)cc23)nc1N |
| InChI | InChI=1S/C19H16F2N8O2/c1-31-19(30)25-14-15(22)26-17(27-16(14)23)13-11-6-10(20)7-24-18(11)29(28-13)8-9-4-2-3-5-12(9)21/h2-7H,8H2,1H3,(H,25,30)(H4,22,23,26,27) |
| InChIKey | QZFHIXARHDBPBY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vericiguat (CHEBI:142432) has role antihypertensive agent (CHEBI:35674) |
| vericiguat (CHEBI:142432) has role soluble guanylate cyclase activator (CHEBI:76022) |
| vericiguat (CHEBI:142432) has role vasodilator agent (CHEBI:35620) |
| vericiguat (CHEBI:142432) is a aminopyrimidine (CHEBI:38338) |
| vericiguat (CHEBI:142432) is a carbamate ester (CHEBI:23003) |
| vericiguat (CHEBI:142432) is a organofluorine compound (CHEBI:37143) |
| vericiguat (CHEBI:142432) is a pyrazolopyridine (CHEBI:46699) |
| IUPAC Name |
|---|
| methyl {4,6-diamino-2-[5-fluoro-1-(2-fluorobenzyl)-1H-pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-5-yl}carbamate |
| INNs | Source |
|---|---|
| vericiguat | WHO MedNet |
| vericiguat | WHO MedNet |
| vericiguatum | WHO MedNet |
| vériciguat | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY1021189 | ChemIDplus |
| BAY-1021189 | ChemIDplus |
| methyl N-[4,6-diamino-2-[5-fluoro-1-[(2-fluorophenyl)methyl]pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-5-yl]carbamate | ChEBI |
| MK-1242 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D11051 | KEGG DRUG |
| US2012022084 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22098890 | Reaxys |
| CAS:1350653-20-1 | ChemIDplus |
| Citations |
|---|