EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H14F8N6O2 |
| Net Charge | 0 |
| Average Mass | 534.367 |
| Monoisotopic Mass | 534.10505 |
| SMILES | OC(CNc1nc(-c2cc(-c3ccon3)n(Cc3ccccc3F)n2)ncc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H14F8N6O2/c22-12-4-2-1-3-11(12)9-35-16(14-5-6-37-34-14)7-15(33-35)18-30-8-13(23)17(32-18)31-10-19(36,20(24,25)26)21(27,28)29/h1-8,36H,9-10H2,(H,30,31,32) |
| InChIKey | CYSJNTQNMDWAJV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasodilator agent A drug used to cause dilation of the blood vessels. anti-inflammatory agent Any compound that has anti-inflammatory effects. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| praliciguat (CHEBI:142431) has role anti-inflammatory agent (CHEBI:67079) |
| praliciguat (CHEBI:142431) has role antihypertensive agent (CHEBI:35674) |
| praliciguat (CHEBI:142431) has role cardiovascular drug (CHEBI:35554) |
| praliciguat (CHEBI:142431) has role soluble guanylate cyclase activator (CHEBI:76022) |
| praliciguat (CHEBI:142431) has role vasodilator agent (CHEBI:35620) |
| praliciguat (CHEBI:142431) is a aminopyrimidine (CHEBI:38338) |
| praliciguat (CHEBI:142431) is a isoxazoles (CHEBI:55373) |
| praliciguat (CHEBI:142431) is a monofluorobenzenes (CHEBI:83575) |
| praliciguat (CHEBI:142431) is a organofluorine compound (CHEBI:37143) |
| praliciguat (CHEBI:142431) is a pyrazoles (CHEBI:26410) |
| praliciguat (CHEBI:142431) is a secondary amino compound (CHEBI:50995) |
| praliciguat (CHEBI:142431) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 1,1,1,3,3,3-hexafluoro-2-[({5-fluoro-2-[1-(2-fluorobenzyl)-5-(1,2-oxazol-3-yl)-1H-pyrazol-3-yl]pyrimidin-4-yl}amino)methyl]propan-2-ol |
| INNs | Source |
|---|---|
| praliciguat | WHO MedNet |
| praliciguat | WHO MedNet |
| praliciguat | WHO MedNet |
| praliciguatum | WHO MedNet |
| Synonym | Source |
|---|---|
| IW-1973 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| WO2014144100 | Patent |
| WO2017095697 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27468841 | Reaxys |
| CAS:1628730-49-3 | ChemIDplus |
| Citations |
|---|