EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N2O2 |
| Net Charge | 0 |
| Average Mass | 304.349 |
| Monoisotopic Mass | 304.12118 |
| SMILES | OCc1ccc(-c2nn(Cc3ccccc3)c3ccccc23)o1 |
| InChI | InChI=1S/C19H16N2O2/c22-13-15-10-11-18(23-15)19-16-8-4-5-9-17(16)21(20-19)12-14-6-2-1-3-7-14/h1-11,22H,12-13H2 |
| InChIKey | OQQVFCKUDYMWGV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lificiguat (CHEBI:142430) has role antineoplastic agent (CHEBI:35610) |
| lificiguat (CHEBI:142430) has role apoptosis inducer (CHEBI:68495) |
| lificiguat (CHEBI:142430) has role platelet aggregation inhibitor (CHEBI:50427) |
| lificiguat (CHEBI:142430) has role soluble guanylate cyclase activator (CHEBI:76022) |
| lificiguat (CHEBI:142430) has role vasodilator agent (CHEBI:35620) |
| lificiguat (CHEBI:142430) is a aromatic primary alcohol (CHEBI:33857) |
| lificiguat (CHEBI:142430) is a furans (CHEBI:24129) |
| lificiguat (CHEBI:142430) is a indazoles (CHEBI:38769) |
| IUPAC Name |
|---|
| [5-(1-benzyl-1H-indazol-3-yl)-2-furyl]methanol |
| INNs | Source |
|---|---|
| lificiguat | WHO MedNet |
| lificiguat | WHO MedNet |
| lificiguat | WHO MedNet |
| lificiguatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-benzyl-3-(5-hydroxymethyl-2-furyl)indazole | ChEBI |
| 3-(5'-hydroxymethyl-2'-furyl)-1-benzylindazole | ChEBI |
| YC-1 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8006642 | Reaxys |
| CAS:170632-47-0 | ChemIDplus |
| Citations |
|---|