EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16N2O2 |
| Net Charge | 0 |
| Average Mass | 304.349 |
| Monoisotopic Mass | 304.12118 |
| SMILES | OCc1ccc(-c2nn(Cc3ccccc3)c3ccccc23)o1 |
| InChI | InChI=1S/C19H16N2O2/c22-13-15-10-11-18(23-15)19-16-8-4-5-9-17(16)21(20-19)12-14-6-2-1-3-7-14/h1-11,22H,12-13H2 |
| InChIKey | OQQVFCKUDYMWGV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lificiguat (CHEBI:142430) has role antineoplastic agent (CHEBI:35610) |
| lificiguat (CHEBI:142430) has role apoptosis inducer (CHEBI:68495) |
| lificiguat (CHEBI:142430) has role platelet aggregation inhibitor (CHEBI:50427) |
| lificiguat (CHEBI:142430) has role soluble guanylate cyclase activator (CHEBI:76022) |
| lificiguat (CHEBI:142430) has role vasodilator agent (CHEBI:35620) |
| lificiguat (CHEBI:142430) is a aromatic primary alcohol (CHEBI:33857) |
| lificiguat (CHEBI:142430) is a furans (CHEBI:24129) |
| lificiguat (CHEBI:142430) is a indazoles (CHEBI:38769) |
| IUPAC Name |
|---|
| [5-(1-benzyl-1H-indazol-3-yl)-2-furyl]methanol |
| INNs | Source |
|---|---|
| lificiguat | WHO MedNet |
| lificiguat | WHO MedNet |
| lificiguat | WHO MedNet |
| lificiguatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| YC-1 | SUBMITTER |
| 1-benzyl-3-(5-hydroxymethyl-2-furyl)indazole | ChEBI |
| 3-(5'-hydroxymethyl-2'-furyl)-1-benzylindazole | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8006642 | Reaxys |
| CAS:170632-47-0 | ChemIDplus |
| Citations |
|---|