EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28N4O3 |
| Net Charge | 0 |
| Average Mass | 444.535 |
| Monoisotopic Mass | 444.21614 |
| SMILES | O=C(Nc1ccc(C[C@@H]2CC[C@H]([C@H](O)c3ccccc3)N2)cc1)[C@@H]1CCc2nccc(=O)n21 |
| InChI | InChI=1S/C26H28N4O3/c31-24-14-15-27-23-13-12-22(30(23)24)26(33)29-19-8-6-17(7-9-19)16-20-10-11-21(28-20)25(32)18-4-2-1-3-5-18/h1-9,14-15,20-22,25,28,32H,10-13,16H2,(H,29,33)/t20-,21+,22-,25+/m0/s1 |
| InChIKey | DJXRIQMCROIRCZ-XOEOCAAJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Application: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vibegron (CHEBI:142418) has role β-adrenergic agonist (CHEBI:35522) |
| vibegron (CHEBI:142418) is a benzenes (CHEBI:22712) |
| vibegron (CHEBI:142418) is a pyrrolidines (CHEBI:38260) |
| vibegron (CHEBI:142418) is a pyrrolopyrimidine (CHEBI:38670) |
| vibegron (CHEBI:142418) is a secondary alcohol (CHEBI:35681) |
| vibegron (CHEBI:142418) is a secondary amine (CHEBI:32863) |
| vibegron (CHEBI:142418) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (6S)-N-[4-({(2S,5R)-5-[(R)-hydroxy(phenyl)methyl]pyrrolidin-2-yl}methyl)phenyl]-4-oxo-4,6,7,8-tetrahydropyrrolo[1,2-a]pyrimidine-6-carboxamide |
| INNs | Source |
|---|---|
| vibegron | WHO MedNet |
| vibegrón | WHO MedNet |
| vibégron | WHO MedNet |
| vibegronum | WHO MedNet |
| Synonym | Source |
|---|---|
| MK-4618 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Beova | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19541234 | Reaxys |
| CAS:1190389-15-1 | ChemIDplus |
| Citations |
|---|