EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14S2 |
| Net Charge | 0 |
| Average Mass | 318.466 |
| Monoisotopic Mass | 318.05369 |
| SMILES | Cc1c2sc3ccccc3c2c(C)c2sc3ccccc3c12 |
| InChI | InChI=1S/C20H14S2/c1-11-17-13-7-3-5-9-15(13)22-20(17)12(2)18-14-8-4-6-10-16(14)21-19(11)18/h3-10H,1-2H3 |
| InChIKey | SMSBYNWSDGBVOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,12-dimethyldibenzo[d,d']benzo[1,2-b:4,5-b']bisthiophene (CHEBI:142414) has role mutagen (CHEBI:25435) |
| 6,12-dimethyldibenzo[d,d']benzo[1,2-b:4,5-b']bisthiophene (CHEBI:142414) is a organic heteropentacyclic compound (CHEBI:38164) |
| 6,12-dimethyldibenzo[d,d']benzo[1,2-b:4,5-b']bisthiophene (CHEBI:142414) is a organosulfur heterocyclic compound (CHEBI:38106) |
| IUPAC Name |
|---|
| 6,12-dimethyldibenzo[d,d']benzo[1,2-b:4,5-b']bisthiophene |
| Synonym | Source |
|---|---|
| 6,12-dimethylbenzo[1,2-b:4,5-b']dithionaphthene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:32953 | Reaxys |
| CAS:37750-86-0 | ChemIDplus |
| Citations |
|---|