EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3 |
| Net Charge | 0 |
| Average Mass | 133.147 |
| Monoisotopic Mass | 133.07389 |
| SMILES | CC(CO)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO3/c1-3(2-7)4(6)5(8)9/h3-4,7H,2,6H2,1H3,(H,8,9)/t3?,4-/m1/s1 |
| InChIKey | YMRZLZUJZNHRLO-SRBOSORUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-D-valine (CHEBI:142413) is a D-valine derivative (CHEBI:84130) |
| 4-hydroxy-D-valine (CHEBI:142413) is a non-proteinogenic amino acid (CHEBI:83820) |
| Incoming Relation(s) |
| 4-hydroxy-D-valine residue (CHEBI:141792) is substituent group from 4-hydroxy-D-valine (CHEBI:142413) |
| IUPAC Name |
|---|
| 4-hydroxy-D-valine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-4-hydroxy-3-methylbutanoic acid | IUPAC |
| D-γ-hydroxyvaline | ChEBI |
| D-Hyv | ChEBI |
| Citations |
|---|