EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FN3 |
| Net Charge | 0 |
| Average Mass | 309.388 |
| Monoisotopic Mass | 309.16413 |
| SMILES | Fc1ccc2nc3c(c2c1)CN(CCCc1cccnc1)CC3 |
| InChI | InChI=1S/C19H20FN3/c20-15-5-6-18-16(11-15)17-13-23(10-7-19(17)22-18)9-2-4-14-3-1-8-21-12-14/h1,3,5-6,8,11-12,22H,2,4,7,9-10,13H2 |
| InChIKey | RZXHTPCHKSYGIB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopamine receptor D2 antagonist An antagonist that binds to and deactivates the dopamine receptor D2, the main receptor for all antipsychotic drugs. |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gevotroline (CHEBI:142391) has role antipsychotic agent (CHEBI:35476) |
| gevotroline (CHEBI:142391) has role dopamine receptor D2 antagonist (CHEBI:131787) |
| gevotroline (CHEBI:142391) is a monofluorobenzenes (CHEBI:83575) |
| gevotroline (CHEBI:142391) is a pyridines (CHEBI:26421) |
| gevotroline (CHEBI:142391) is a β-carbolines (CHEBI:60834) |
| gevotroline (CHEBI:142391) is conjugate base of gevotroline(1+) (CHEBI:142392) |
| Incoming Relation(s) |
| gevotroline(1+) (CHEBI:142392) is conjugate acid of gevotroline (CHEBI:142391) |
| IUPAC Name |
|---|
| 8-fluoro-2-[3-(pyridin-3-yl)propyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| INNs | Source |
|---|---|
| gevotrolina | WHO MedNet |
| gevotroline | WHO MedNet |
| gévotroline | WHO MedNet |
| gevotrolinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 8-fluoro-2,3,4,5-tetrahydro-2-[3-(3-pyridinyl)propyl]1H-pyrido[4,3-b]indole | ChEBI |
| WY 47384 | ChEBI |
| WY-47384 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Gevotroline | Wikipedia |
| US4636563 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6069263 | Reaxys |
| CAS:107266-06-8 | ChemIDplus |
| Citations |
|---|