EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO4 |
| Net Charge | 0 |
| Average Mass | 169.136 |
| Monoisotopic Mass | 169.03751 |
| SMILES | Cc1ccc(O)c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7NO4/c1-4-2-3-5(9)7(10)6(4)8(11)12/h2-3,9-10H,1H3 |
| InChIKey | JNHOFPQUTOBFOM-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-3-nitrocatechol (CHEBI:142347) is a methylcatechol (CHEBI:25289) |
| 4-methyl-3-nitrocatechol (CHEBI:142347) is a nitrotoluene (CHEBI:25566) |
| 4-methyl-3-nitrocatechol (CHEBI:142347) is conjugate acid of 4-methyl-3-nitrocatechol(1−) (CHEBI:142288) |
| Incoming Relation(s) |
| 4-methyl-3-nitrocatechol(1−) (CHEBI:142288) is conjugate base of 4-methyl-3-nitrocatechol (CHEBI:142347) |
| IUPAC Name |
|---|
| 4-methyl-3-nitrobenzene-1,2-diol |
| Manual Xrefs | Databases |
|---|---|
| CPD-18109 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:92538-95-9 | ChemIDplus |
| Citations |
|---|