EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29O10P3 |
| Net Charge | 0 |
| Average Mass | 462.309 |
| Monoisotopic Mass | 462.09736 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H29O10P3/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-23-27(19,20)25-28(21,22)24-26(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H,21,22)(H2,16,17,18)/b14-9+,15-11+ |
| InChIKey | QIOOKVHMPPJVHS-YFVJMOTDSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farnesyl triphosphate (CHEBI:17961) is a polyprenol triphosphate (CHEBI:26203) |
| farnesyl triphosphate (CHEBI:17961) is conjugate acid of farnesyl triphosphate(3−) (CHEBI:58331) |
| Incoming Relation(s) |
| farnesyl triphosphate(3−) (CHEBI:58331) is conjugate base of farnesyl triphosphate (CHEBI:17961) |
| IUPAC Name |
|---|
| 3,7,11-trimethyldodeca-2,6,10-trien-1-yl tetrahydrogen triphosphate |
| Synonyms | Source |
|---|---|
| farnesol triphosphate | IUBMB |
| Farnesyl triphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03115 | KEGG COMPOUND |
| C03115 | KEGG COMPOUND |
| LMPR03010006 | LIPID MAPS |