EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6N2O4 |
| Net Charge | 0 |
| Average Mass | 182.135 |
| Monoisotopic Mass | 182.03276 |
| SMILES | Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H6N2O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3 |
| InChIKey | INYDMNPNDHRJQJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dinitrotoluene (CHEBI:142285) has role explosive (CHEBI:63490) |
| 3,4-dinitrotoluene (CHEBI:142285) is a dinitrotoluene (CHEBI:23822) |
| IUPAC Name |
|---|
| 4-methyl-1,2-dinitrobenzene |
| Synonyms | Source |
|---|---|
| 1-methyl-3,4-dinitrobenzene | ChEBI |
| 3,4-DNT | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 3,4-dinitrotoluene | UniProt |
| Citations |
|---|