EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O4 |
| Net Charge | 0 |
| Average Mass | 330.424 |
| Monoisotopic Mass | 330.18311 |
| SMILES | [H][C@]12CC[C@@]34O[C@@H]3[C@@](C)(C=C)C(=O)C=C4[C@]1(C)CC(=O)[C@@H](O)C2(C)C |
| InChI | InChI=1S/C20H26O4/c1-6-18(4)14(22)9-13-19(5)10-11(21)15(23)17(2,3)12(19)7-8-20(13)16(18)24-20/h6,9,12,15-16,23H,1,7-8,10H2,2-5H3/t12-,15-,16-,18+,19-,20+/m1/s1 |
| InChIKey | OYQREFBZDOJEAT-WKSFTGSUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Manihot esculenta (ncbitaxon:3983) | root (BTO:0001188) | Article (Sakai, T. and Nakagawa, Y. (1988) Diterpenic stress metabolites from Cassava roots. Phytochemistry, 27(12), 3769-3779.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yucalexin P8 (CHEBI:142277) has parent hydride ent-pimara-9(11),15-diene (CHEBI:50064) |
| yucalexin P8 (CHEBI:142277) has role plant metabolite (CHEBI:76924) |
| yucalexin P8 (CHEBI:142277) is a enone (CHEBI:51689) |
| yucalexin P8 (CHEBI:142277) is a epoxide (CHEBI:32955) |
| yucalexin P8 (CHEBI:142277) is a organic heterotetracyclic compound (CHEBI:38163) |
| yucalexin P8 (CHEBI:142277) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (3α,5β,10α,13α,14β)-3-hydroxy-8,14-epoxypimara-9(11),15-diene-2,12-dione |
| Synonyms | Source |
|---|---|
| ent-8α,14α-epoxy-3β-hydroxypimara-9(11),15-diene-2,12-dione | ChEBI |
| yucalexin P-8 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 35014235 | ChemSpider |
| FDB015693 | FooDB |
| HMDB0036755 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6771707 | Reaxys |