EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O2 |
| Net Charge | 0 |
| Average Mass | 274.404 |
| Monoisotopic Mass | 274.19328 |
| SMILES | C=C(C)CCC[C@H](C)CCOC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H26O2/c1-15(2)8-7-9-16(3)12-13-20-18(19)14-17-10-5-4-6-11-17/h4-6,10-11,16H,1,7-9,12-14H2,2-3H3/t16-/m0/s1 |
| InChIKey | SKZDJVXLRPCFQC-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3,7-dimethyloct-7-en-1-yl phenylacetate (CHEBI:142274) has functional parent phenylacetic acid (CHEBI:30745) |
| (3S)-3,7-dimethyloct-7-en-1-yl phenylacetate (CHEBI:142274) has role flavouring agent (CHEBI:35617) |
| (3S)-3,7-dimethyloct-7-en-1-yl phenylacetate (CHEBI:142274) is a carboxylic ester (CHEBI:33308) |
| (3S)-3,7-dimethyloct-7-en-1-yl phenylacetate (CHEBI:142274) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (3S)-3,7-dimethyloct-7-en-1-yl phenylacetate |
| Synonyms | Source |
|---|---|
| [(3S)-3,7-dimethyloct-7-enyl] 2-phenylacetate | ChEBI |
| (S)-3,7-dimethyl-7-octenyl benzeneacetate | HMDB |
| (3S)-3,7-dimethyloct-7-enyl-2-phenylacetate | ChEBI |
| (S)-3,7-dimethyloct-7-enyl phenylacetate | HMDB |
| rhodinyl phenylacetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037191 | HMDB |
| FDB016193 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23623724 | Reaxys |
| CAS:10486-14-3 | ChemIDplus |
| Citations |
|---|