EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O5 |
| Net Charge | 0 |
| Average Mass | 336.343 |
| Monoisotopic Mass | 336.09977 |
| SMILES | CC(C)=CCc1c(O)ccc2c1oc1c3ccc(O)cc3oc(=O)c21 |
| InChI | InChI=1S/C20H16O5/c1-10(2)3-5-12-15(22)8-7-14-17-19(25-18(12)14)13-6-4-11(21)9-16(13)24-20(17)23/h3-4,6-9,21-22H,5H2,1-2H3 |
| InChIKey | MQKLGUOASGICKG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina abyssinica (ncbitaxon:1237573) | bark (BTO:0001301) | PubMed (20337486) | Isolated from stem bark |
| Glycyrrhiza inflata (ncbitaxon:74614) | root (BTO:0001188) | PubMed (28835349) | |
| Phaseolus coccineus (ncbitaxon:3886) | whole plant (BTO:0001461) | Article (O'Neill, M.J., Adesanya, S.A. and Roberts, M.F. (1984) Isosojagol, a coumestan from Phaseolus coccineus. Phytochemistry, 23(11), 2704-2705.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isosojagol (CHEBI:142265) has functional parent coumestrol (CHEBI:3908) |
| isosojagol (CHEBI:142265) has role plant metabolite (CHEBI:76924) |
| isosojagol (CHEBI:142265) is a coumestans (CHEBI:72577) |
| isosojagol (CHEBI:142265) is a olefinic compound (CHEBI:78840) |
| isosojagol (CHEBI:142265) is a organic heterotetracyclic compound (CHEBI:38163) |
| isosojagol (CHEBI:142265) is a polyphenol (CHEBI:26195) |
| isosojagol (CHEBI:142265) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 3,9-dihydroxy-10-(3-methylbut-2-en-1-yl)-6H-[1]benzofuro[3,2-c]chromen-6-one |
| Synonyms | Source |
|---|---|
| 3,9-dihydroxy-10-(3-methyl-2-butenyl)-6H-benzofuro[3,2-c][1]benzopyran-6-one | HMDB |
| 3,9-dihydroxy-10-(3-methylbut-2-enyl)-[1]benzofuro[3,2-c]chromen-6-one | ChEBI |
| 3,9-dihydroxy-10-prenylcoumestan | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00010050 | KNApSAcK |
| FDB001947 | FooDB |
| HMDB0030141 | HMDB |
| LMPK12090009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6743158 | Reaxys |
| CAS:94390-15-5 | KNApSAcK |
| CAS:94390-15-5 | ChemIDplus |
| Citations |
|---|