EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O6 |
| Net Charge | 0 |
| Average Mass | 386.444 |
| Monoisotopic Mass | 386.17294 |
| SMILES | COc1cc(CCC(=O)/C=C/CCc2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C22H26O6/c1-26-19-12-15(9-11-18(19)24)8-10-17(23)7-5-4-6-16-13-20(27-2)22(25)21(14-16)28-3/h5,7,9,11-14,24-25H,4,6,8,10H2,1-3H3/b7-5+ |
| InChIKey | BGYDJLLXKGVQBP-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zingiber officinale (ncbitaxon:94328) | rhizome (BTO:0001181) | Article (Endo, K., Kanno, E. and Oshima, Y. (1990) Structures of antifungal diarylheptenones, gingerenones A, B, C and isogingerenone B, isolated from the rhizomes of Zingiber officinale. Phytochemistry, 29(3), 797-799.) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gingerenone B (CHEBI:142262) has role plant metabolite (CHEBI:76924) |
| gingerenone B (CHEBI:142262) is a diarylheptanoid (CHEBI:78802) |
| gingerenone B (CHEBI:142262) is a enone (CHEBI:51689) |
| gingerenone B (CHEBI:142262) is a guaiacols (CHEBI:134251) |
| IUPAC Name |
|---|
| (4E)-7-(4-hydroxy-3,5-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one |
| Synonym | Source |
|---|---|
| (E)-7-(4-hydroxy-3,5-dimethoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4476436 | ChemSpider |
| HMDB0035405 | HMDB |
| FDB014080 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3569667 | Reaxys |
| CAS:128700-98-1 | HMDB |
| Citations |
|---|