EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@@]12CC=C3C(=CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CC/C=C(\C)CO)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C30H48O2/c1-20(19-31)9-8-10-21(2)22-13-17-30(7)24-11-12-25-27(3,4)26(32)15-16-28(25,5)23(24)14-18-29(22,30)6/h9,11,14,21-22,25-26,31-32H,8,10,12-13,15-19H2,1-7H3/b20-9+/t21-,22-,25+,26+,28-,29-,30+/m1/s1 |
| InChIKey | AOXXVRDKZLRGTJ-AZIDVCJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma concinna (ncbitaxon:5314) | fruit body (BTO:0000487) | PubMed (11908995) | |
| Ganoderma lucidum (ncbitaxon:5315) | |||
| mycelium (BTO:0001436) | PubMed (29748985) | Strain: G0119 | |
| fruit body (BTO:0000487) | PubMed (28912878) | ||
| Ganoderma pfeifferi (ncbitaxon:34464) | fruit body (BTO:0000487) | PubMed (12628419) | |
| Ganoderma resinaceum (ncbitaxon:34465) | fruit body (BTO:0000487) | PubMed (23790868) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ganoderol B (CHEBI:142261) has parent hydride lanostane (CHEBI:20265) |
| ganoderol B (CHEBI:142261) has role antiviral agent (CHEBI:22587) |
| ganoderol B (CHEBI:142261) has role fungal metabolite (CHEBI:76946) |
| ganoderol B (CHEBI:142261) has role hepatoprotective agent (CHEBI:62868) |
| ganoderol B (CHEBI:142261) is a 3β-sterol (CHEBI:35348) |
| ganoderol B (CHEBI:142261) is a primary allylic alcohol (CHEBI:134394) |
| ganoderol B (CHEBI:142261) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3β,24E)-lanosta-7,9(11),24-triene-3,26-diol |
| Synonyms | Source |
|---|---|
| ganodermadiol | ChemIDplus |
| (+)-ganoderol B | ChemIDplus |
| ganoderol B | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00023868 | KNApSAcK |
| FDB013983 | FooDB |
| HMDB0035314 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:104700-96-1 | KNApSAcK |
| CAS:104700-96-1 | ChemIDplus |
| Citations |
|---|