EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O6 |
| Net Charge | 0 |
| Average Mass | 392.492 |
| Monoisotopic Mass | 392.21989 |
| SMILES | [H][C@]12[C@@H](OC(=O)[C@@H](C)CC)CC[C@H](C)[C@@]1(C)C[C@@]1(C(=C)COC1=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C22H32O6/c1-7-12(2)19(24)28-16-9-8-13(3)21(6)11-22(14(4)10-26-20(22)25)18(17(16)21)27-15(5)23/h12-13,16-18H,4,7-11H2,1-3,5-6H3/t12-,13-,16-,17+,18+,21+,22+/m0/s1 |
| InChIKey | RLFYIIYBXGSPOM-OATMBDEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petasites japonicus (ncbitaxon:186965) | flower stalk (BTO:0002244) | Article (Naya, K., Hayashi, M., Takagi, I., Nakamura, S. and Kobayashi, M. (1972) The structural elucidation of sesquiterpene lactones from Petasites japonicus Maxim. Bull. Chem. Soc. Jpn., 45(12), 3673-3685.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrofukinolide (CHEBI:142257) has role plant metabolite (CHEBI:76924) |
| dihydrofukinolide (CHEBI:142257) is a acetate ester (CHEBI:47622) |
| dihydrofukinolide (CHEBI:142257) is a oxaspiro compound (CHEBI:37948) |
| dihydrofukinolide (CHEBI:142257) is a sesquiterpene lactone (CHEBI:37667) |
| dihydrofukinolide (CHEBI:142257) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3R,3'R,3a'R,4'S,7'S,7a'R)-3'-acetoxy-7',7a'-dimethyl-4-methylene-2-oxodecahydrospiro[furan-3,2'-inden]-4'-yl (2S)-2-methylbutanoate |
| Manual Xrefs | Databases |
|---|---|
| C00021356 | KNApSAcK |
| FDB013186 | FooDB |
| HMDB0034662 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1271946 | Reaxys |
| CAS:41059-95-4 | FooDB |
| CAS:41059-95-4 | KNApSAcK |