EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O5 |
| Net Charge | 0 |
| Average Mass | 328.449 |
| Monoisotopic Mass | 328.22497 |
| SMILES | CCC(C)C1C=C(C(O)CC(O)C(O)C(=O)O)C(C(C)CC)C1 |
| InChI | InChI=1S/C18H32O5/c1-5-10(3)12-7-13(11(4)6-2)14(8-12)15(19)9-16(20)17(21)18(22)23/h8,10-13,15-17,19-21H,5-7,9H2,1-4H3,(H,22,23) |
| InChIKey | RKOUCPMGBBKLNK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| auxin a (CHEBI:142254) is a carbocyclic compound (CHEBI:33598) |
| auxin a (CHEBI:142254) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| auxin a (CHEBI:142254) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| 4-deoxy-5-C-(3,5-di-sec-butylcyclopent-1-en-1-yl)pentonic acid |
| Synonyms | Source |
|---|---|
| 5-(2,4-di-sec-butyl-cyclopent-5-enyl)-2,3,5-trihydroxy-valeric acid | ChEBI |
| 5-(3,5-di-sec-butylcyclopent-1-enyl)-2,3,5-trihydroxyvaleric acid | ChemIDplus |
| 5-C-(3,5-bis(1-methylpropyl)-1-cyclopenten-1-yl)-4-deoxy-pentonic acid | ChEBI |
| auxen triolic acid | ChEBI |
| auxentriolic acid | ChEBI |
| auxin-a | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 83749 | ChemSpider |
| FDB017851 | FooDB |
| HMDB0038483 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3152986 | Reaxys |
| CAS:491-14-5 | ChemIDplus |