EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O4 |
| Net Charge | 0 |
| Average Mass | 286.412 |
| Monoisotopic Mass | 286.21441 |
| SMILES | O=C(O)CCCCCCCCC(=O)CCCCCCO |
| InChI | InChI=1S/C16H30O4/c17-14-10-6-5-8-12-15(18)11-7-3-1-2-4-9-13-16(19)20/h17H,1-14H2,(H,19,20) |
| InChIKey | ZNMHENLYDLACAS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus aurantiifolia (ncbitaxon:159033) | - | PubMed (18828637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-hydroxy-10-oxohexadecanoic acid (CHEBI:142246) has role plant metabolite (CHEBI:76924) |
| 16-hydroxy-10-oxohexadecanoic acid (CHEBI:142246) is a oxo fatty acid (CHEBI:59644) |
| 16-hydroxy-10-oxohexadecanoic acid (CHEBI:142246) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| IUPAC Name |
|---|
| 16-hydroxy-10-oxohexadecanoic acid |
| Synonym | Source |
|---|---|
| 10-oxo-16-hydroxyhexadecanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB021204 | FooDB |
| HMDB0041287 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:53833-25-3 | HMDB |
| Citations |
|---|