EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O2 |
| Net Charge | 0 |
| Average Mass | 254.414 |
| Monoisotopic Mass | 254.22458 |
| SMILES | CCCCCCCCCCCC/C=C/CC(=O)O |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h13-14H,2-12,15H2,1H3,(H,17,18)/b14-13+ |
| InChIKey | PCBKWKNYISJGPJ-BUHFOSPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trifolium pratense (ncbitaxon:57577) | leaf (BTO:0000713) | PubMed (14250500) | |
| Vicia faba (ncbitaxon:3906) | leaf (BTO:0000713) | PubMed (1126340) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-3-hexadecenoic acid (CHEBI:142241) has role plant metabolite (CHEBI:76924) |
| (3E)-3-hexadecenoic acid (CHEBI:142241) is a hexadecenoic acid (CHEBI:24548) |
| IUPAC Name |
|---|
| (3E)-hexadec-3-enoic acid |
| Synonyms | Source |
|---|---|
| (3E)-3-Hexadecensäure | ChEBI |
| 3E-hexadecenoic acid | LIPID MAPS |
| 3-E-hexadecenoic acid | ChEBI |
| acide (3E)-3-hexadécénoïque | ChEBI |
| trans-3-hexadecenoic acid | ChEBI |
| trans-Δ3-hexadecenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4471843 | ChemSpider |
| LMFA01030266 | LIPID MAPS |
| Citations |
|---|