EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6N2O |
| Net Charge | 0 |
| Average Mass | 170.171 |
| Monoisotopic Mass | 170.04801 |
| SMILES | N#CC(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C10H6N2O/c11-5-10(13)8-6-12-9-4-2-1-3-7(8)9/h1-4,6,12H |
| InChIKey | YWKCWNQLRJKTBZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (26352477) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-carbonyl nitrile (CHEBI:142139) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| indole-3-carbonyl nitrile (CHEBI:142139) is a indoles (CHEBI:24828) |
| indole-3-carbonyl nitrile (CHEBI:142139) is a α-ketonitrile (CHEBI:51852) |
| IUPAC Name |
|---|
| 1H-indole-3-carbonyl cyanide |
| Synonyms | Source |
|---|---|
| 1H-indol-3-yl(oxo)acetonitrile | ChEBI |
| ICN | ChEBI |
| indole-3-carbonyl nitrile | ChEBI |
| indolyl-3-carbonyl nitrile | ChEBI |
| UniProt Name | Source |
|---|---|
| indole-3-carbonyl nitrile | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4988806 | Reaxys |
| Citations |
|---|