EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6N2O2 |
| Net Charge | 0 |
| Average Mass | 186.170 |
| Monoisotopic Mass | 186.04293 |
| SMILES | N#CC(=O)c1cnc2cccc(O)c12 |
| InChI | InChI=1S/C10H6N2O2/c11-4-9(14)6-5-12-7-2-1-3-8(13)10(6)7/h1-3,5,12-13H |
| InChIKey | KVUDODPZCDAFRS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (26352477) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-indole-3-carbonyl nitrile (CHEBI:142138) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 4-hydroxy-indole-3-carbonyl nitrile (CHEBI:142138) is a hydroxyindoles (CHEBI:84729) |
| 4-hydroxy-indole-3-carbonyl nitrile (CHEBI:142138) is a α-ketonitrile (CHEBI:51852) |
| IUPAC Name |
|---|
| 4-hydroxy-1H-indole-3-carbonyl cyanide |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxy-1H-indol-3-yl)-2-keto-acetonitrile | ChEBI |
| 2-(4-hydroxy-1H-indol-3-yl)-2-oxoacetonitrile | ChEBI |
| 4-hydroxy-α-oxo-1H-indole-3-acetonitrile | ChEBI |
| 4-OH-ICN | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-indole-3-carbonyl nitrile | UniProt |
| Citations |
|---|