EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36N4O6 |
| Net Charge | 0 |
| Average Mass | 584.673 |
| Monoisotopic Mass | 584.26348 |
| SMILES | C=CC1=C(C)/C(=C/c2nc(Cc3nc(/C=C4\NC(=O)C(C=C)=C4C)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)NC1=O |
| InChI | InChI=1S/C33H36N4O6/c1-7-20-16(3)26(36-32(20)42)13-24-18(5)22(9-11-30(38)39)28(34-24)15-29-23(10-12-31(40)41)19(6)25(35-29)14-27-17(4)21(8-2)33(43)37-27/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,42)(H,37,43)(H,38,39)(H,40,41)/b26-13-,27-14- |
| InChIKey | OQNSGJHDCGJNHV-IFADSCNNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bilirubin IIIα (CHEBI:142136) is a biladienes (CHEBI:36735) |
| bilirubin IIIα (CHEBI:142136) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Names |
|---|
| 2,18-diethenyl-3,7,13,17-tetramethyl-1,19-dioxo-1,10,19,22,23,24-hexahydro-21H-biline-8,12-dipropanoic acid |
| bilirubin IIIα |
| Synonyms | Source |
|---|---|
| 3,7,13,17-tetramethyl-1,19-dioxo-2,18-divinyl-1,10,19,22,23,24-hexahydro-21H-biline-8,12-dipropanoic acid | IUPAC |
| 8,12-bis(2-carboxyethyl)-3,7,13,17-tetramethyl-2,18-divinylbiladiene-ac-1,19(21H,24H)-dione | JCBN |
| bilirubin-IIIα | IUPAC |
| Citations |
|---|