EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO4 |
| Net Charge | 0 |
| Average Mass | 373.493 |
| Monoisotopic Mass | 373.22531 |
| SMILES | [H][C@@]12CC[C@@H](C)C[C@@]1([H])C=C[C@@]([H])(/C=C/C)[C@@]2(C)/C(O)=C1\C(=O)[C@H](CO)N(C)C1=O |
| InChI | InChI=1S/C22H31NO4/c1-5-6-15-9-8-14-11-13(2)7-10-16(14)22(15,3)20(26)18-19(25)17(12-24)23(4)21(18)27/h5-6,8-9,13-17,24,26H,7,10-12H2,1-4H3/b6-5+,20-18-/t13-,14-,15-,16-,17+,22-/m1/s1 |
| InChIKey | QNQBPPQLRODXET-HMHJLHGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium equiseti (ncbitaxon:61235) | - | PubMed (8132493) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. quorum sensing inhibitor Any compound that interferes with bacterial communication (quorum sensing, QS). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| equisetin (CHEBI:142135) has functional parent trichosetin (CHEBI:142133) |
| equisetin (CHEBI:142135) has role antibacterial agent (CHEBI:33282) |
| equisetin (CHEBI:142135) has role fungal metabolite (CHEBI:76946) |
| equisetin (CHEBI:142135) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| equisetin (CHEBI:142135) has role quorum sensing inhibitor (CHEBI:138977) |
| equisetin (CHEBI:142135) is a enol (CHEBI:33823) |
| equisetin (CHEBI:142135) is a octahydronaphthalenes (CHEBI:138397) |
| equisetin (CHEBI:142135) is a primary alcohol (CHEBI:15734) |
| equisetin (CHEBI:142135) is a tetramic acids (CHEBI:140155) |
| equisetin (CHEBI:142135) is conjugate acid of equisetin(1−) (CHEBI:142060) |
| Incoming Relation(s) |
| equisetin(1−) (CHEBI:142060) is conjugate base of equisetin (CHEBI:142135) |
| IUPAC Name |
|---|
| (3Z,5S)-3-[{(1S,2R,4aS,6R,8aR)-1,6-dimethyl-2-[(1E)-prop-1-en-1-yl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl}(hydroxy)methylidene]-5-(hydroxymethyl)-1-methylpyrrolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| N-methyltrichosetin | ChEBI |
| (−)-equisetin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5773365 | Reaxys |
| CAS:57749-43-6 | ChemIDplus |
| Citations |
|---|