EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO4 |
| Net Charge | 0 |
| Average Mass | 373.493 |
| Monoisotopic Mass | 373.22531 |
| SMILES | [H][C@@]12CC[C@@H](C)C[C@@]1([H])C=C[C@@]([H])(/C=C/C)[C@@]2(C)/C(O)=C1\C(=O)[C@H](CO)N(C)C1=O |
| InChI | InChI=1S/C22H31NO4/c1-5-6-15-9-8-14-11-13(2)7-10-16(14)22(15,3)20(26)18-19(25)17(12-24)23(4)21(18)27/h5-6,8-9,13-17,24,26H,7,10-12H2,1-4H3/b6-5+,20-18-/t13-,14-,15-,16-,17+,22-/m1/s1 |
| InChIKey | QNQBPPQLRODXET-HMHJLHGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium equiseti (ncbitaxon:61235) | - | PubMed (8132493) |
| Roles Classification |
|---|
| Biological Roles: | quorum sensing inhibitor Any compound that interferes with bacterial communication (quorum sensing, QS). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| equisetin (CHEBI:142135) has functional parent trichosetin (CHEBI:142133) |
| equisetin (CHEBI:142135) has role antibacterial agent (CHEBI:33282) |
| equisetin (CHEBI:142135) has role fungal metabolite (CHEBI:76946) |
| equisetin (CHEBI:142135) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| equisetin (CHEBI:142135) has role quorum sensing inhibitor (CHEBI:138977) |
| equisetin (CHEBI:142135) is a enol (CHEBI:33823) |
| equisetin (CHEBI:142135) is a octahydronaphthalenes (CHEBI:138397) |
| equisetin (CHEBI:142135) is a primary alcohol (CHEBI:15734) |
| equisetin (CHEBI:142135) is a tetramic acids (CHEBI:140155) |
| equisetin (CHEBI:142135) is conjugate acid of equisetin(1−) (CHEBI:142060) |
| Incoming Relation(s) |
| equisetin(1−) (CHEBI:142060) is conjugate base of equisetin (CHEBI:142135) |
| IUPAC Name |
|---|
| (3Z,5S)-3-[{(1S,2R,4aS,6R,8aR)-1,6-dimethyl-2-[(1E)-prop-1-en-1-yl]-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl}(hydroxy)methylidene]-5-(hydroxymethyl)-1-methylpyrrolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| N-methyltrichosetin | ChEBI |
| (−)-equisetin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5773365 | Reaxys |
| CAS:57749-43-6 | ChemIDplus |
| Citations |
|---|