EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30F2N2O4 |
| Net Charge | 0 |
| Average Mass | 460.521 |
| Monoisotopic Mass | 460.21736 |
| SMILES | O=c1ccc2c([C@@H](O)CNCCCCCCOCC(F)(F)c3ccccc3)ccc(O)c2n1 |
| InChI | InChI=1S/C25H30F2N2O4/c26-25(27,18-8-4-3-5-9-18)17-33-15-7-2-1-6-14-28-16-22(31)19-10-12-21(30)24-20(19)11-13-23(32)29-24/h3-5,8-13,22,28,30-31H,1-2,6-7,14-17H2,(H,29,32)/t22-/m0/s1 |
| InChIKey | SFYAXIFVXBKRPK-QFIPXVFZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Application: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abediterol (CHEBI:142077) has role β-adrenergic agonist (CHEBI:35522) |
| abediterol (CHEBI:142077) is a ether (CHEBI:25698) |
| abediterol (CHEBI:142077) is a monohydroxyquinoline (CHEBI:38775) |
| abediterol (CHEBI:142077) is a organofluorine compound (CHEBI:37143) |
| abediterol (CHEBI:142077) is a quinolone (CHEBI:23765) |
| abediterol (CHEBI:142077) is a secondary alcohol (CHEBI:35681) |
| abediterol (CHEBI:142077) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 5-[(1R)-2-{[6-(2,2-difluoro-2-phenylethoxy)hexyl]amino}-1-hydroxyethyl]-8-hydroxyquinolin-2(1H)-one |
| INNs | Source |
|---|---|
| abediterol | WHO MedNet |
| abediterolum | WHO MedNet |
| abéditérol | WHO MedNet |
| Synonyms | Source |
|---|---|
| LAS100977 | DrugBank |
| 5-[(1R)-2-{[6-(2,2-difluoro-2-phenylethoxy)hexyl]amino}-1-hydroxyethyl]-8-hydroxy-1,2-dihydroquinolin-2-one | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| Abediterol | Wikipedia |
| D10219 | KEGG DRUG |
| DB12100 | DrugBank |
| WO2006122788 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12781197 | Reaxys |
| CAS:915133-65-2 | ChemIDplus |
| Citations |
|---|