EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28NO4 |
| Net Charge | -1 |
| Average Mass | 358.458 |
| Monoisotopic Mass | 358.20238 |
| SMILES | [H][C@@]12CC[C@@H](C)C[C@@]1([H])C=C[C@@]([H])(/C=C/C)[C@@]2(C)/C([O-])=C1/C(=O)N[C@@H](CO)C1=O |
| InChI | InChI=1S/C21H29NO4/c1-4-5-14-8-7-13-10-12(2)6-9-15(13)21(14,3)19(25)17-18(24)16(11-23)22-20(17)26/h4-5,7-8,12-16,23,25H,6,9-11H2,1-3H3,(H,22,26)/p-1/b5-4+,19-17-/t12-,13-,14-,15-,16+,21-/m1/s1 |
| InChIKey | TYCWBBBQIATAJE-GEZPOGBYSA-M |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. phytotoxin Any toxin produced by a plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichosetin(1−) (CHEBI:142061) has role antibacterial agent (CHEBI:33282) |
| trichosetin(1−) (CHEBI:142061) has role phytotoxin (CHEBI:38231) |
| trichosetin(1−) (CHEBI:142061) is a organic anion (CHEBI:25696) |
| trichosetin(1−) (CHEBI:142061) is conjugate base of trichosetin (CHEBI:142133) |
| Incoming Relation(s) |
| trichosetin (CHEBI:142133) is conjugate acid of trichosetin(1−) (CHEBI:142061) |
| UniProt Name | Source |
|---|---|
| trichosetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17993 | MetaCyc |
| Citations |
|---|