EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O |
| Net Charge | 0 |
| Average Mass | 220.356 |
| Monoisotopic Mass | 220.18272 |
| SMILES | C=C(C)[C@@H]1CCC2=C[C@H](O)C[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C15H24O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11-12,14,16H,1,5-7,9H2,2-4H3/t11-,12-,14-,15+/m1/s1 |
| InChIKey | GFNWRKNVTHDNPV-GBOPCIDUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia oxyphylla (ncbitaxon:125261) | fruit (BTO:0000486) | Article (Xu, Junju; Su, Jia; Li, Yan; Tan, Ninghua. Chemistry of Natural Compounds, 2013, vol. 49 (3), p. 457 - 461. [Khim. Prir. Soedin. 2013, p. 390 - 393]) | |
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (15602686) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-nootkatol (CHEBI:142043) has role fungal metabolite (CHEBI:76946) |
| α-nootkatol (CHEBI:142043) has role plant metabolite (CHEBI:76924) |
| α-nootkatol (CHEBI:142043) is a 6-isopropenyl-4,4a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-2-ol (CHEBI:142044) |
| IUPAC Name |
|---|
| (2R,4R,4aS,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-2,3,4,4a,5,6,7,8-octahydronaphthalen-2-ol |
| Synonyms | Source |
|---|---|
| 2-epinootkatol | ChEBI |
| 2β-hydroxyvalencene | ChEBI |
| 4α,4aα-dimethyl-6β-(1-methylethenyl)-2,3,4,4a,5,6,7,8-octahydronaphthalene-2β-ol | ChEBI |
| cis-nootkatol | ChEBI |
| UniProt Name | Source |
|---|---|
| α-nootkatol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2212838 | Reaxys |
| Citations |
|---|