EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O7 |
| Net Charge | 0 |
| Average Mass | 362.378 |
| Monoisotopic Mass | 362.13655 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1([C@H](O)C3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23C=C[C@H](O)[C@@]1(C)C(=O)O3 |
| InChI | InChI=1S/C19H22O7/c1-8-13(21)18-7-17(8,25)5-3-9(18)19-6-4-10(20)16(2,15(24)26-19)12(19)11(18)14(22)23/h4,6,9-13,20-21,25H,1,3,5,7H2,2H3,(H,22,23)/t9-,10+,11-,12-,13-,16-,17+,18-,19-/m1/s1 |
| InChIKey | LUPUPJAJWHJARD-VKRREQRESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15β-OH gibberellin A3 (CHEBI:142024) is a C19-gibberellin (CHEBI:20858) |
| 15β-OH gibberellin A3 (CHEBI:142024) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| 15β-OH gibberellin A3 (CHEBI:142024) is a lactone (CHEBI:25000) |
| IUPAC Names |
|---|
| (1S,2S,4aR,4bR,7S,9S,9aR,10S,10aR)-2,7,9-trihydroxy-1-methyl-8-methylidene-13-oxo-1,2,4b,5,6,7,8,9,10,10a-decahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid |
| 2β,7α,9β-trihydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibb-3-ene-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA3 15β-OH | ChEBI |
| (1S,2S,4aR,4bR,7S,9S,9aR,10S,10aR)-2,7,9-trihydroxy-1-methyl-8-methylene-13-oxo-1,2,4b,5,6,7,8,9,10,10a-decahydro-4a,1-(epoxymethano)-7,9a-methanobenzo[a]azulene-10-carboxylic acid | IUPAC |
| ent-3α,10β,13,15α-tetrahydroxy-20-norgibberella-1,16-diene-7,19-dioic acid 19,10-lactone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5159772 | Reaxys |
| Citations |
|---|