EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O2 |
| Net Charge | 0 |
| Average Mass | 310.397 |
| Monoisotopic Mass | 310.16813 |
| SMILES | [H][C@@]12Nc3ccccc3[C@@]13CCN1CC4=CCO[C@@H](O)[C@]2([H])[C@@]4([H])C[C@]13[H] |
| InChI | InChI=1S/C19H22N2O2/c22-18-16-12-9-15-19(6-7-21(15)10-11(12)5-8-23-18)13-3-1-2-4-14(13)20-17(16)19/h1-5,12,15-18,20,22H,6-10H2/t12-,15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | UFUDXCDPABDFHK-SRCYXDNASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Strychnos dolichothyrsa (IPNI:547167-1) | bark (BTO:0001301) | PubMed (17402076) | |
| Strychnos matopensis (ncbitaxon:1040897) | root (BTO:0001188) | Article (Massiot, G et al. Alkaloids from roots of Strychnos matopensis (1988). Phytochemistry, Vol 27(10), p 3293-3304.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caracurine VII (CHEBI:141968) has role plant metabolite (CHEBI:76924) |
| caracurine VII (CHEBI:141968) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| caracurine VII (CHEBI:141968) is a organic heterohexacyclic compound (CHEBI:51914) |
| caracurine VII (CHEBI:141968) is a primary alcohol (CHEBI:15734) |
| caracurine VII (CHEBI:141968) is a tertiary amino compound (CHEBI:50996) |
| caracurine VII (CHEBI:141968) is conjugate base of 17,18-epoxy-17-hydroxycur-19-ene(1+) (CHEBI:231746) |
| Incoming Relation(s) |
| 17,18-epoxy-17-hydroxycur-19-ene(1+) (CHEBI:231746) is conjugate acid of caracurine VII (CHEBI:141968) |
| IUPAC Name |
|---|
| (17R)-19,20-didehydro-17,18-epoxycuran-17-ol |
| Synonyms | Source |
|---|---|
| Wieland-Gumlich aldehyde | ChemIDplus |
| caracurine | ChemIDplus |
| caracurine VII | ChemIDplus |
| caracurin VII | ChEBI |
| 1-deacetyldiaboline | ChemIDplus |
| desacetyldiaboline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Wieland-Gumlich_aldehyde | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:43170 | Reaxys |
| CAS:466-85-3 | ChemIDplus |
| Citations |
|---|