EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H26N2O6 |
| Net Charge | 0 |
| Average Mass | 474.513 |
| Monoisotopic Mass | 474.17909 |
| SMILES | [H][C@@]12C[C@]3([H])N(CC[C@@]45c6ccccc6N([C@@]43OC(=O)c3c5ccc(O)c3O)[C@]1([H])C(=O)OC)C/C2=C/C |
| InChI | InChI=1S/C27H26N2O6/c1-3-14-13-28-11-10-26-16-6-4-5-7-18(16)29-22(25(33)34-2)15(14)12-20(28)27(26,29)35-24(32)21-17(26)8-9-19(30)23(21)31/h3-9,15,20,22,30-31H,10-13H2,1-2H3/b14-3-/t15-,20-,22-,26-,27-/m0/s1 |
| InChIKey | AQFWYTNPVDQLGS-VBCBCQGPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Voacalgine A (CHEBI:141965) is a monoterpenoid indole alkaloid (CHEBI:65323) |