EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O2 |
| Net Charge | 0 |
| Average Mass | 324.424 |
| Monoisotopic Mass | 324.18378 |
| SMILES | [H][C@]12N3CCC(C(C(=O)OC)=C4Nc5ccccc5[C@]41CC3)[C@]2([H])CC |
| InChI | InChI=1S/C20H24N2O2/c1-3-12-13-8-10-22-11-9-20(18(12)22)14-6-4-5-7-15(14)21-17(20)16(13)19(23)24-2/h4-7,12-13,18,21H,3,8-11H2,1-2H3/t12-,13?,18+,20+/m0/s1 |
| InChIKey | RLAKWLFUMAABBE-BMWAJPDPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tubotaiwine (CHEBI:141960) is a monoterpenoid indole alkaloid (CHEBI:65323) |