EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N2O7 |
| Net Charge | 0 |
| Average Mass | 586.685 |
| Monoisotopic Mass | 586.26790 |
| SMILES | [H][C@]1(OC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)C23C[C@]4([H])N5C/C(=C/C)[C@]([H])(C[C@@]5([H])[C@@]2([H])N(C)c2ccccc23)C14C(=O)OC |
| InChI | InChI=1S/C34H38N2O7/c1-7-20-18-36-24-16-22(20)34(32(38)42-6)27(36)17-33(21-10-8-9-11-23(21)35(2)30(24)33)31(34)43-28(37)13-12-19-14-25(39-3)29(41-5)26(15-19)40-4/h7-15,22,24,27,30-31H,16-18H2,1-6H3/b13-12+,20-7-/t22-,24-,27-,30+,31-,33?,34?/m0/s1 |
| InChIKey | MMWULTFKKMQANL-HERIOXFGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trimethoxy-3,4,5-cinnamate-vincamajine (CHEBI:141959) is a monoterpenoid indole alkaloid (CHEBI:65323) |